C14H14N2O2 — CID 91435648
4-methyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine-4-carboxamide (PubChem CID 91435648) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-methyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine-4-carboxamide.
| Compound Name | 4-methyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine-4-carboxamide |
|---|---|
| PubChem CID | 91435648 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-methyl-6H-pyrrolo[1,2-a][4,1]benzoxazepine-4-carboxamide |
| SMILES | CC1(C(N)=O)OCc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C14H14N2O2/c1-14(13(15)17)12-7-4-8-16(12)11-6-3-2-5-10(11)9-18-14/h2-8H,9H2,1H3,(H2,15,17) |
| InChIKey | DZPLPJGCGQPLSE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |