C11H13F5 — CID 91437573
1,2,4,5-tetramethyl-3-(1,1,2,2,2-pentafluoroethyl)cyclopenta-1,3-diene (PubChem CID 91437573) has the molecular formula C11H13F5 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-(1,1,2,2,2-pentafluoroethyl)cyclopenta-1,3-diene.
| Compound Name | 1,2,4,5-tetramethyl-3-(1,1,2,2,2-pentafluoroethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 91437573 |
| Molecular Formula | C11H13F5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,2,4,5-tetramethyl-3-(1,1,2,2,2-pentafluoroethyl)cyclopenta-1,3-diene |
| SMILES | CC1=C(C)C(C)C(C)=C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F5/c1-5-6(2)8(4)9(7(5)3)10(12,13)11(14,15)16/h5H,1-4H3 |
| InChIKey | GQLCYOXDJRPBNH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|