C25H27N5O3 — CID 91438480
4-[[1-[ethoxy(quinolin-8-yl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylic acid (PubChem CID 91438480) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[1-[ethoxy(quinolin-8-yl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[[1-[ethoxy(quinolin-8-yl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91438480 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[[1-[ethoxy(quinolin-8-yl)methyl]benzimidazol-2-yl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(c1cccc2cccnc12)n1c(NC2CCN(C(=O)O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C25H27N5O3/c1-2-33-23(19-9-5-7-17-8-6-14-26-22(17)19)30-21-11-4-3-10-20(21)28-24(30)27-18-12-15-29(16-13-18)25(31)32/h3-11,14,18,23H,2,12-13,15-16H2,1H3,(H,27,28)(H,31,32) |
| InChIKey | DGIFERVEZUHVOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |