C14H19NO4 — CID 91439989
tert-butyl 2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)acetate (PubChem CID 91439989) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl 2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)acetate.
| Compound Name | tert-butyl 2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 91439989 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | tert-butyl 2-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1c(O)c2c(c1O)CC=CC2 |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)19-11(16)8-15-12(17)9-6-4-5-7-10(9)13(15)18/h4-5,17-18H,6-8H2,1-3H3 |
| InChIKey | CDWPUDSOQZIDHQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|