C16H19N2O4P — CID 91440895
1-[(2-dimethoxyphosphorylphenyl)methyl]-3-phenylurea (PubChem CID 91440895) has the molecular formula C16H19N2O4P and a molecular weight of 334.31 g/mol. Its IUPAC name is 1-[(2-dimethoxyphosphorylphenyl)methyl]-3-phenylurea.
| Compound Name | 1-[(2-dimethoxyphosphorylphenyl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 91440895 |
| Molecular Formula | C16H19N2O4P |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-[(2-dimethoxyphosphorylphenyl)methyl]-3-phenylurea |
| SMILES | COP(=O)(OC)c1ccccc1CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H19N2O4P/c1-21-23(20,22-2)15-11-7-6-8-13(15)12-17-16(19)18-14-9-4-3-5-10-14/h3-11H,12H2,1-2H3,(H2,17,18,19) |
| InChIKey | WEQSLGHCXLONGC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|