C16H17Cl2N2O4P — CID 91201895
1-(3,4-dichlorophenyl)-3-[(2-dimethoxyphosphorylphenyl)methyl]urea (PubChem CID 91201895) has the molecular formula C16H17Cl2N2O4P and a molecular weight of 403.20 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(2-dimethoxyphosphorylphenyl)methyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(2-dimethoxyphosphorylphenyl)methyl]urea |
|---|---|
| PubChem CID | 91201895 |
| Molecular Formula | C16H17Cl2N2O4P |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(2-dimethoxyphosphorylphenyl)methyl]urea |
| SMILES | COP(=O)(OC)c1ccccc1CNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N2O4P/c1-23-25(22,24-2)15-6-4-3-5-11(15)10-19-16(21)20-12-7-8-13(17)14(18)9-12/h3-9H,10H2,1-2H3,(H2,19,20,21) |
| InChIKey | GLPMFDCJMPFXEP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|