C28H33FN4O4S — CID 91443753
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 91443753) has the molecular formula C28H33FN4O4S and a molecular weight of 540.66 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91443753 |
| Molecular Formula | C28H33FN4O4S |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-6-[2-(3-fluoro-4-propan-2-yloxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | Cc1cc(C)n2nc(SC3C(=O)CC(CCc4ccc(OC(C)C)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C28H33FN4O4S/c1-16(2)36-23-10-9-19(14-21(23)29)11-12-28(20-7-5-6-8-20)15-22(34)24(25(35)37-28)38-27-31-26-30-17(3)13-18(4)33(26)32-27/h9-10,13-14,16,20,24H,5-8,11-12,15H2,1-4H3 |
| InChIKey | KCWNRAZTMRNJDS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|