C7H6F5N3O — CID 91443981
N-(2,2,3,3,3-pentafluoropropyl)-1H-imidazole-5-carboxamide (PubChem CID 91443981) has the molecular formula C7H6F5N3O and a molecular weight of 243.13 g/mol. Its IUPAC name is N-(2,2,3,3,3-pentafluoropropyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-(2,2,3,3,3-pentafluoropropyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 91443981 |
| Molecular Formula | C7H6F5N3O |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-(2,2,3,3,3-pentafluoropropyl)-1H-imidazole-5-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)(F)F)c1cnc[nH]1 |
| InChI | InChI=1S/C7H6F5N3O/c8-6(9,7(10,11)12)2-14-5(16)4-1-13-3-15-4/h1,3H,2H2,(H,13,15)(H,14,16) |
| InChIKey | AIHHVZDFMRWLGM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|