C16H20O2 — CID 91445932
2-[4-(3-methyl-4-methylidenecyclohexyl)phenyl]acetic acid (PubChem CID 91445932) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-[4-(3-methyl-4-methylidenecyclohexyl)phenyl]acetic acid.
| Compound Name | 2-[4-(3-methyl-4-methylidenecyclohexyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 91445932 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-[4-(3-methyl-4-methylidenecyclohexyl)phenyl]acetic acid |
| SMILES | C=C1CCC(c2ccc(CC(=O)O)cc2)CC1C |
| InChI | InChI=1S/C16H20O2/c1-11-3-6-15(9-12(11)2)14-7-4-13(5-8-14)10-16(17)18/h4-5,7-8,12,15H,1,3,6,9-10H2,2H3,(H,17,18) |
| InChIKey | ZYEMMZABPVBNPE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|