C22H25N3O5 — CID 91446061
18-hydroxy-5-methyl-16-[2-(triazol-1-yl)ethoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),5,12,15,17-pentaene-2,8-dione (PubChem CID 91446061) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 18-hydroxy-5-methyl-16-[2-(triazol-1-yl)ethoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),5,12,15,17-pentaene-2,8-dione.
| Compound Name | 18-hydroxy-5-methyl-16-[2-(triazol-1-yl)ethoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),5,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 91446061 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 18-hydroxy-5-methyl-16-[2-(triazol-1-yl)ethoxy]-3-oxabicyclo[12.4.0]octadeca-1(14),5,12,15,17-pentaene-2,8-dione |
| SMILES | CC1=CCC(=O)CCCC=Cc2cc(OCCn3ccnn3)cc(O)c2C(=O)OC1 |
| InChI | InChI=1S/C22H25N3O5/c1-16-7-8-18(26)6-4-2-3-5-17-13-19(29-12-11-25-10-9-23-24-25)14-20(27)21(17)22(28)30-15-16/h3,5,7,9-10,13-14,27H,2,4,6,8,11-12,15H2,1H3 |
| InChIKey | HMZQENKLXGKFLE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|