C18H17ClN4 — CID 91448644
4-(2-chlorophenyl)-6-cyclopentyl-5-isocyano-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 91448644) has the molecular formula C18H17ClN4 and a molecular weight of 324.81 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-cyclopentyl-5-isocyano-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-6-cyclopentyl-5-isocyano-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 91448644 |
| Molecular Formula | C18H17ClN4 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-(2-chlorophenyl)-6-cyclopentyl-5-isocyano-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(C2CCCC2)=Nc2[nH]ncc2C1c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN4/c1-20-17-15(12-8-4-5-9-14(12)19)13-10-21-23-18(13)22-16(17)11-6-2-3-7-11/h4-5,8-11,15,17H,2-3,6-7H2,(H,21,23) |
| InChIKey | OKRDIYTVTNWNEH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|