C19H21ClN6 — CID 90852524
4-(2-chlorophenyl)-5-isocyano-6-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine (PubChem CID 90852524) has the molecular formula C19H21ClN6 and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-isocyano-6-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-5-isocyano-6-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 90852524 |
| Molecular Formula | C19H21ClN6 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-(2-chlorophenyl)-5-isocyano-6-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-1H-pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(CN2CCN(C)CC2)=Nc2[nH]ncc2C1c1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN6/c1-21-18-16(12-26-9-7-25(2)8-10-26)23-19-14(11-22-24-19)17(18)13-5-3-4-6-15(13)20/h3-6,11,17-18H,7-10,12H2,2H3,(H,22,24) |
| InChIKey | FVTPDYQQFORWLW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|