C23H24O5 — CID 91451674
(1E,4Z,6E)-7-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-1-(3-methoxy-4-methylphenyl)hepta-1,4,6-trien-3-one (PubChem CID 91451674) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1E,4Z,6E)-7-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-1-(3-methoxy-4-methylphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-7-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-1-(3-methoxy-4-methylphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 91451674 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (1E,4Z,6E)-7-(4-hydroxy-3-methoxyphenyl)-5-(hydroxymethyl)-1-(3-methoxy-4-methylphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C(/C=C/c2ccc(O)c(OC)c2)CO)ccc1C |
| InChI | InChI=1S/C23H24O5/c1-16-4-5-17(13-22(16)27-2)8-10-20(25)12-19(15-24)7-6-18-9-11-21(26)23(14-18)28-3/h4-14,24,26H,15H2,1-3H3/b7-6+,10-8+,19-12- |
| InChIKey | CLGQGKJFHYPQIV-VECAAEJLSA-N |
| XLogP | 3.93 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|