C6H9NO3 — CID 91452563
3-methoxy-1-methylpyrrole-2,5-diol (PubChem CID 91452563) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-methoxy-1-methylpyrrole-2,5-diol.
| Compound Name | 3-methoxy-1-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91452563 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3-methoxy-1-methylpyrrole-2,5-diol |
| SMILES | COc1cc(O)n(C)c1O |
| InChI | InChI=1S/C6H9NO3/c1-7-5(8)3-4(10-2)6(7)9/h3,8-9H,1-2H3 |
| InChIKey | POTMZCASNXKDQL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |