C4F6O3S — CID 91452676
(2,2,2-trifluoroacetyl)sulfanyl 2,2,2-trifluoroacetate (PubChem CID 91452676) has the molecular formula C4F6O3S and a molecular weight of 242.10 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl)sulfanyl 2,2,2-trifluoroacetate.
| Compound Name | (2,2,2-trifluoroacetyl)sulfanyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91452676 |
| Molecular Formula | C4F6O3S |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | (2,2,2-trifluoroacetyl)sulfanyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OSC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4F6O3S/c5-3(6,7)1(11)13-14-2(12)4(8,9)10 |
| InChIKey | HIAOEBZHEDUQHN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|