C22H31N3O6S — CID 91453187
cis-(1R,2R)-N-(cyanomethyl)-N-hydroxy-2-[[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide (PubChem CID 91453187) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is cis-(1R,2R)-N-(cyanomethyl)-N-hydroxy-2-[[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(cyanomethyl)-N-hydroxy-2-[[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91453187 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | cis-(1R,2R)-N-(cyanomethyl)-N-hydroxy-2-[[4-(2-morpholin-4-ylethoxy)phenyl]sulfonylmethyl]cyclohexane-1-carboxamide |
| SMILES | N#CCN(O)C(=O)[C@@H]1CCCC[C@H]1CS(=O)(=O)c1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H31N3O6S/c23-9-10-25(27)22(26)21-4-2-1-3-18(21)17-32(28,29)20-7-5-19(6-8-20)31-16-13-24-11-14-30-15-12-24/h5-8,18,21,27H,1-4,10-17H2/t18-,21+/m0/s1 |
| InChIKey | LWDIHEOZPFKIFA-GHTZIAJQSA-N |
| XLogP | 1.72 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|