C24H30F2O6S2 — CID 91454441
1-adamantyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate (PubChem CID 91454441) has the molecular formula C24H30F2O6S2 and a molecular weight of 516.63 g/mol. Its IUPAC name is 1-adamantyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate.
| Compound Name | 1-adamantyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
|---|---|
| PubChem CID | 91454441 |
| Molecular Formula | C24H30F2O6S2 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 1-adamantyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
| SMILES | O=C(CS1(OS(=O)(=O)C(F)(F)C(=O)OC23CC4CC(CC(C4)C2)C3)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H30F2O6S2/c25-24(26,22(28)31-23-13-17-10-18(14-23)12-19(11-17)15-23)34(29,30)32-33(8-4-5-9-33)16-21(27)20-6-2-1-3-7-20/h1-3,6-7,17-19H,4-5,8-16H2 |
| InChIKey | FSRGBLHDZCQYFN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |