C24H28F2O7S2 — CID 91131937
(4-oxo-1-adamantyl) 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate (PubChem CID 91131937) has the molecular formula C24H28F2O7S2 and a molecular weight of 530.61 g/mol. Its IUPAC name is (4-oxo-1-adamantyl) 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate.
| Compound Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
|---|---|
| PubChem CID | 91131937 |
| Molecular Formula | C24H28F2O7S2 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | (4-oxo-1-adamantyl) 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
| SMILES | O=C(CS1(OS(=O)(=O)C(F)(F)C(=O)OC23CC4CC(C2)C(=O)C(C4)C3)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H28F2O7S2/c25-24(26,22(29)32-23-12-16-10-18(13-23)21(28)19(11-16)14-23)35(30,31)33-34(8-4-5-9-34)15-20(27)17-6-2-1-3-7-17/h1-3,6-7,16,18-19H,4-5,8-15H2 |
| InChIKey | HTCZIAKYCRGWSZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |