C33H58O — CID 91455412
6-[7a-methyl-4-[2-(3-methyl-5-pentan-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,3-dimethylheptan-2-ol (PubChem CID 91455412) has the molecular formula C33H58O and a molecular weight of 470.83 g/mol. Its IUPAC name is 6-[7a-methyl-4-[2-(3-methyl-5-pentan-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,3-dimethylheptan-2-ol.
| Compound Name | 6-[7a-methyl-4-[2-(3-methyl-5-pentan-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,3-dimethylheptan-2-ol |
|---|---|
| PubChem CID | 91455412 |
| Molecular Formula | C33H58O |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.45 |
| IUPAC Name | 6-[7a-methyl-4-[2-(3-methyl-5-pentan-2-ylcyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2,3-dimethylheptan-2-ol |
| SMILES | CCCC(C)C1CC(=CC=C2CCCC3(C)C2CCC3C(C)CCC(C)C(C)(C)O)CC(C)C1 |
| InChI | InChI=1S/C33H58O/c1-9-11-24(3)29-21-23(2)20-27(22-29)15-16-28-12-10-19-33(8)30(17-18-31(28)33)25(4)13-14-26(5)32(6,7)34/h15-16,23-26,29-31,34H,9-14,17-22H2,1-8H3 |
| InChIKey | DNRAJWGGURWLMH-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |