C20H18N6O3 — CID 91455663
2-[4-(2H-tetrazol-5-yl)phenyl]iminobutyl 2-hydroxyindole-1-carboxylate (PubChem CID 91455663) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[4-(2H-tetrazol-5-yl)phenyl]iminobutyl 2-hydroxyindole-1-carboxylate.
| Compound Name | 2-[4-(2H-tetrazol-5-yl)phenyl]iminobutyl 2-hydroxyindole-1-carboxylate |
|---|---|
| PubChem CID | 91455663 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[4-(2H-tetrazol-5-yl)phenyl]iminobutyl 2-hydroxyindole-1-carboxylate |
| SMILES | CC/C(COC(=O)n1c(O)cc2ccccc21)=N\c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C20H18N6O3/c1-2-15(21-16-9-7-13(8-10-16)19-22-24-25-23-19)12-29-20(28)26-17-6-4-3-5-14(17)11-18(26)27/h3-11,27H,2,12H2,1H3,(H,22,23,24,25)/b21-15+ |
| InChIKey | ALMAZAXOEXVIKY-RCCKNPSSSA-N |
| XLogP | 3.69 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|