C20H29NO2 — CID 91459628
8-(1,3-dimethylpiperidin-4-yl)-2,3-dimethylchromen-4-one;ethane (PubChem CID 91459628) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 8-(1,3-dimethylpiperidin-4-yl)-2,3-dimethylchromen-4-one;ethane.
| Compound Name | 8-(1,3-dimethylpiperidin-4-yl)-2,3-dimethylchromen-4-one;ethane |
|---|---|
| PubChem CID | 91459628 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 8-(1,3-dimethylpiperidin-4-yl)-2,3-dimethylchromen-4-one;ethane |
| SMILES | CC.Cc1oc2c(C3CCN(C)CC3C)cccc2c(=O)c1C |
| InChI | InChI=1S/C18H23NO2.C2H6/c1-11-10-19(4)9-8-14(11)15-6-5-7-16-17(20)12(2)13(3)21-18(15)16;1-2/h5-7,11,14H,8-10H2,1-4H3;1-2H3 |
| InChIKey | BYVVDVVYXIRUHV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |