C16H18N2O — CID 53306994
(2S,7S)-4,11-dimethyl-4,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 53306994) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S,7S)-4,11-dimethyl-4,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | (2S,7S)-4,11-dimethyl-4,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 53306994 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S,7S)-4,11-dimethyl-4,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CN1CC[C@@H]2C(=O)c3cn(C)c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C16H18N2O/c1-17-7-6-11-12(8-17)10-4-3-5-14-15(10)13(16(11)19)9-18(14)2/h3-5,9,11-12H,6-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | JKAFZWDZTNAGMN-NWDGAFQWSA-N |
| XLogP | 2.41 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|