C18H31N5O2 — CID 91459698
tert-butyl 4-[(6-imino-7-propyl-2,3-dihydro-1,4-diazepin-5-yl)amino]piperidine-1-carboxylate (PubChem CID 91459698) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl 4-[(6-imino-7-propyl-2,3-dihydro-1,4-diazepin-5-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-imino-7-propyl-2,3-dihydro-1,4-diazepin-5-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91459698 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl 4-[(6-imino-7-propyl-2,3-dihydro-1,4-diazepin-5-yl)amino]piperidine-1-carboxylate |
| SMILES | [H]/N=C1\C(CCC)=NCCN=C1NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H31N5O2/c1-5-6-14-15(19)16(21-10-9-20-14)22-13-7-11-23(12-8-13)17(24)25-18(2,3)4/h13,19H,5-12H2,1-4H3,(H,21,22)/b19-15+ |
| InChIKey | FFUXFQRSNHTOTD-XDJHFCHBSA-N |
| XLogP | 2.65 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|