C12H22N2 — CID 91463393
4a,5,8,8a-tetrahydroquinoxaline;ethane (PubChem CID 91463393) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4a,5,8,8a-tetrahydroquinoxaline;ethane.
| Compound Name | 4a,5,8,8a-tetrahydroquinoxaline;ethane |
|---|---|
| PubChem CID | 91463393 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4a,5,8,8a-tetrahydroquinoxaline;ethane |
| SMILES | C1=CCC2N=CC=NC2C1.CC.CC |
| InChI | InChI=1S/C8H10N2.2C2H6/c1-2-4-8-7(3-1)9-5-6-10-8;2*1-2/h1-2,5-8H,3-4H2;2*1-2H3 |
| InChIKey | LEMMMTMYTQVWHF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|