C28H40N6O11S — CID 91467298
2-[4-(carboxymethyl)-7-(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]-5-[2-[1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanylethylamino]-5-oxopentanoic acid (PubChem CID 91467298) has the molecular formula C28H40N6O11S and a molecular weight of 668.73 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]-5-[2-[1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanylethylamino]-5-oxopentanoic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]-5-[2-[1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanylethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91467298 |
| Molecular Formula | C28H40N6O11S |
| Molecular Weight | 668.73 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-(2-methoxy-2-oxoethyl)-1,4,7-triazonan-1-yl]-5-[2-[1-[2-(2,5-dioxopyrrol-1-yl)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanylethylamino]-5-oxopentanoic acid |
| SMILES | COC(=O)CN1CCN(CC(=O)O)CCN(C(CCC(=O)NCCSc2cc(O)n(CCN3C(=O)C=CC3=O)c2O)C(=O)O)CC1 |
| InChI | InChI=1S/C28H40N6O11S/c1-45-26(41)18-31-8-7-30(17-25(39)40)9-11-32(12-10-31)19(28(43)44)2-3-21(35)29-6-15-46-20-16-24(38)34(27(20)42)14-13-33-22(36)4-5-23(33)37/h4-5,16,19,38,42H,2-3,6-15,17-18H2,1H3,(H,29,35)(H,39,40)(H,43,44) |
| InChIKey | ZODMDASZJVJVOG-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 222.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.73 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|