C37H51N3O8S — CID 123918535
methyl 4-[[3-[1-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoate (PubChem CID 123918535) has the molecular formula C37H51N3O8S and a molecular weight of 697.90 g/mol. Its IUPAC name is methyl 4-[[3-[1-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[[3-[1-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 123918535 |
| Molecular Formula | C37H51N3O8S |
| Molecular Weight | 697.90 g/mol |
| Exact Mass | 697.34 |
| IUPAC Name | methyl 4-[[3-[1-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-2,5-dihydroxypyrrol-3-yl]sulfanyl-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobut-2-enoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCn1c(O)cc(SCC(NC(=O)C=CC(=O)OC)C(=O)OC)c1O |
| InChI | InChI=1S/C37H51N3O8S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-32(41)38-26-27-40-34(43)28-31(36(40)45)49-29-30(37(46)48-3)39-33(42)24-25-35(44)47-2/h5-6,8-9,11-12,14-15,17-18,20-21,24-25,28,30,43,45H,4,7,10,13,16,19,22-23,26-27,29H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | HDIYBBBRQBYHMD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.90 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|