C18H29N3O7S — CID 123332397
2-acetamido-3-[2,5-dihydroxy-1-[6-(2-methoxyethylamino)-6-oxohexyl]pyrrol-3-yl]sulfanylpropanoic acid (PubChem CID 123332397) has the molecular formula C18H29N3O7S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-acetamido-3-[2,5-dihydroxy-1-[6-(2-methoxyethylamino)-6-oxohexyl]pyrrol-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[2,5-dihydroxy-1-[6-(2-methoxyethylamino)-6-oxohexyl]pyrrol-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 123332397 |
| Molecular Formula | C18H29N3O7S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-acetamido-3-[2,5-dihydroxy-1-[6-(2-methoxyethylamino)-6-oxohexyl]pyrrol-3-yl]sulfanylpropanoic acid |
| SMILES | COCCNC(=O)CCCCCn1c(O)cc(SCC(NC(C)=O)C(=O)O)c1O |
| InChI | InChI=1S/C18H29N3O7S/c1-12(22)20-13(18(26)27)11-29-14-10-16(24)21(17(14)25)8-5-3-4-6-15(23)19-7-9-28-2/h10,13,24-25H,3-9,11H2,1-2H3,(H,19,23)(H,20,22)(H,26,27) |
| InChIKey | KNHVKQOKBQPQMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|