C25H31IN4O2 — CID 91471006
N-(4-iodobenzoyl)-4-[4-(4-methylcyclohexyl)piperazin-1-yl]benzohydrazide (PubChem CID 91471006) has the molecular formula C25H31IN4O2 and a molecular weight of 546.45 g/mol. Its IUPAC name is N-(4-iodobenzoyl)-4-[4-(4-methylcyclohexyl)piperazin-1-yl]benzohydrazide.
| Compound Name | N-(4-iodobenzoyl)-4-[4-(4-methylcyclohexyl)piperazin-1-yl]benzohydrazide |
|---|---|
| PubChem CID | 91471006 |
| Molecular Formula | C25H31IN4O2 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N-(4-iodobenzoyl)-4-[4-(4-methylcyclohexyl)piperazin-1-yl]benzohydrazide |
| SMILES | CC1CCC(N2CCN(c3ccc(C(=O)N(N)C(=O)c4ccc(I)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H31IN4O2/c1-18-2-10-22(11-3-18)28-14-16-29(17-15-28)23-12-6-20(7-13-23)25(32)30(27)24(31)19-4-8-21(26)9-5-19/h4-9,12-13,18,22H,2-3,10-11,14-17,27H2,1H3 |
| InChIKey | GJMVNOFWHFSYJT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|