C12H9BrN2S — CID 91473343
3-(3-bromophenyl)-1H-2,1,3-benzothiadiazole (PubChem CID 91473343) has the molecular formula C12H9BrN2S and a molecular weight of 293.19 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1H-2,1,3-benzothiadiazole.
| Compound Name | 3-(3-bromophenyl)-1H-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 91473343 |
| Molecular Formula | C12H9BrN2S |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 3-(3-bromophenyl)-1H-2,1,3-benzothiadiazole |
| SMILES | Brc1cccc(N2SNc3ccccc32)c1 |
| InChI | InChI=1S/C12H9BrN2S/c13-9-4-3-5-10(8-9)15-12-7-2-1-6-11(12)14-16-15/h1-8,14H |
| InChIKey | HENZRHKYIDNLID-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|