C27H32N2O7 — CID 91473762
(2S)-2-[cyclopentanecarbonyl(phenoxy)amino]-4-[2-(3,5-dimethylanilino)-2-oxoethyl]pentanedioic acid (PubChem CID 91473762) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is (2S)-2-[cyclopentanecarbonyl(phenoxy)amino]-4-[2-(3,5-dimethylanilino)-2-oxoethyl]pentanedioic acid.
| Compound Name | (2S)-2-[cyclopentanecarbonyl(phenoxy)amino]-4-[2-(3,5-dimethylanilino)-2-oxoethyl]pentanedioic acid |
|---|---|
| PubChem CID | 91473762 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2S)-2-[cyclopentanecarbonyl(phenoxy)amino]-4-[2-(3,5-dimethylanilino)-2-oxoethyl]pentanedioic acid |
| SMILES | Cc1cc(C)cc(NC(=O)CC(C[C@@H](C(=O)O)N(Oc2ccccc2)C(=O)C2CCCC2)C(=O)O)c1 |
| InChI | InChI=1S/C27H32N2O7/c1-17-12-18(2)14-21(13-17)28-24(30)16-20(26(32)33)15-23(27(34)35)29(25(31)19-8-6-7-9-19)36-22-10-4-3-5-11-22/h3-5,10-14,19-20,23H,6-9,15-16H2,1-2H3,(H,28,30)(H,32,33)(H,34,35)/t20?,23-/m0/s1 |
| InChIKey | OYMIYIZLNFTTRO-AKRCKQFNSA-N |
| XLogP | 4.19 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|