C27H34N2O5 — CID 91300066
(2S)-2-[cyclopentanecarbonyl-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]amino]-3-methylbutanoic acid (PubChem CID 91300066) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is (2S)-2-[cyclopentanecarbonyl-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[cyclopentanecarbonyl-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91300066 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (2S)-2-[cyclopentanecarbonyl-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]amino]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)cc(NC(=O)Cc2ccc(ON(C(=O)C3CCCC3)[C@H](C(=O)O)C(C)C)cc2)c1 |
| InChI | InChI=1S/C27H34N2O5/c1-17(2)25(27(32)33)29(26(31)21-7-5-6-8-21)34-23-11-9-20(10-12-23)16-24(30)28-22-14-18(3)13-19(4)15-22/h9-15,17,21,25H,5-8,16H2,1-4H3,(H,28,30)(H,32,33)/t25-/m0/s1 |
| InChIKey | SPRNDHJFRVRDKA-VWLOTQADSA-N |
| XLogP | 4.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|