C17H33NO2 — CID 91476008
6-butyl-7,8-dimethoxy-5-methyldeca-6,8-dien-1-amine (PubChem CID 91476008) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 6-butyl-7,8-dimethoxy-5-methyldeca-6,8-dien-1-amine.
| Compound Name | 6-butyl-7,8-dimethoxy-5-methyldeca-6,8-dien-1-amine |
|---|---|
| PubChem CID | 91476008 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 6-butyl-7,8-dimethoxy-5-methyldeca-6,8-dien-1-amine |
| SMILES | CC=C(OC)C(OC)=C(CCCC)C(C)CCCCN |
| InChI | InChI=1S/C17H33NO2/c1-6-8-12-15(14(3)11-9-10-13-18)17(20-5)16(7-2)19-4/h7,14H,6,8-13,18H2,1-5H3 |
| InChIKey | YGMUECKIOYDXOH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|