About [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine
[(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine (PubChem CID 118612611) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine |
| PubChem CID | 118612611 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine |
| SMILES | C=C1/C=C\C(OC)=C(\C)CCCCC1CN |
| InChI | InChI=1S/C14H23NO/c1-11-8-9-14(16-3)12(2)6-4-5-7-13(11)10-15/h8-9,13H,1,4-7,10,15H2,2-3H3/b9-8-,14-12+ |
| InChIKey | KICGHBXNZBVQLL-VMXLIBDNSA-N |
| XLogP | 3.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine?
The IUPAC name of [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine (CID 118612611) is [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine.
What is the SMILES notation for [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine?
The canonical SMILES for [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine is C=C1/C=C\C(OC)=C(\C)CCCCC1CN.
What is the InChIKey of [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine?
The InChIKey is KICGHBXNZBVQLL-VMXLIBDNSA-N. The full InChI is InChI=1S/C14H23NO/c1-11-8-9-14(16-3)12(2)6-4-5-7-13(11)10-15/h8-9,13H,1,4-7,10,15H2,2-3H3/b9-8-,14-12+.
What are the key properties of [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine?
[(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine has a molecular weight of 221.34 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5E)-5-methoxy-6-methyl-2-methylidenecyclodeca-3,5-dien-1-yl]methanamine is sourced from PubChem (CID 118612611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).