C15H23NO2 — CID 142808388
6-[(3E,5Z)-5,6-dimethoxyhepta-1,3,5-trien-3-yl]cyclohex-3-en-1-amine (PubChem CID 142808388) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 6-[(3E,5Z)-5,6-dimethoxyhepta-1,3,5-trien-3-yl]cyclohex-3-en-1-amine.
| Compound Name | 6-[(3E,5Z)-5,6-dimethoxyhepta-1,3,5-trien-3-yl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 142808388 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 6-[(3E,5Z)-5,6-dimethoxyhepta-1,3,5-trien-3-yl]cyclohex-3-en-1-amine |
| SMILES | C=C/C(=C\C(OC)=C(/C)OC)C1CC=CCC1N |
| InChI | InChI=1S/C15H23NO2/c1-5-12(10-15(18-4)11(2)17-3)13-8-6-7-9-14(13)16/h5-7,10,13-14H,1,8-9,16H2,2-4H3/b12-10+,15-11- |
| InChIKey | MWYYJVJPWNZMQO-NJFTWXLASA-N |
| XLogP | 2.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|