C23H33N5O4 — CID 91476942
tert-butyl N-[2-[[4-amino-2-(ethoxymethyl)-9-propyl-3H-imidazo[4,5-c]quinolin-8-yl]oxy]ethyl]carbamate (PubChem CID 91476942) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-amino-2-(ethoxymethyl)-9-propyl-3H-imidazo[4,5-c]quinolin-8-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-amino-2-(ethoxymethyl)-9-propyl-3H-imidazo[4,5-c]quinolin-8-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 91476942 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | tert-butyl N-[2-[[4-amino-2-(ethoxymethyl)-9-propyl-3H-imidazo[4,5-c]quinolin-8-yl]oxy]ethyl]carbamate |
| SMILES | CCCc1c(OCCNC(=O)OC(C)(C)C)ccc2nc(N)c3[nH]c(COCC)nc3c12 |
| InChI | InChI=1S/C23H33N5O4/c1-6-8-14-16(31-12-11-25-22(29)32-23(3,4)5)10-9-15-18(14)19-20(21(24)26-15)28-17(27-19)13-30-7-2/h9-10H,6-8,11-13H2,1-5H3,(H2,24,26)(H,25,29)(H,27,28) |
| InChIKey | NWUKUVAUSXGKIQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|