C26H26N4O2 — CID 91478131
10-(benzylamino)-12-(4-methylpiperazin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),3,5,9,11,13-hexaen-8-one (PubChem CID 91478131) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 10-(benzylamino)-12-(4-methylpiperazin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),3,5,9,11,13-hexaen-8-one.
| Compound Name | 10-(benzylamino)-12-(4-methylpiperazin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),3,5,9,11,13-hexaen-8-one |
|---|---|
| PubChem CID | 91478131 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 10-(benzylamino)-12-(4-methylpiperazin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),3,5,9,11,13-hexaen-8-one |
| SMILES | CN1CCN(c2cc(NCc3ccccc3)c3c4c(onc24)C2C=CC=CC2C3=O)CC1 |
| InChI | InChI=1S/C26H26N4O2/c1-29-11-13-30(14-12-29)21-15-20(27-16-17-7-3-2-4-8-17)22-23-24(21)28-32-26(23)19-10-6-5-9-18(19)25(22)31/h2-10,15,18-19,27H,11-14,16H2,1H3 |
| InChIKey | UNNIJLMQMUEXRW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |