C33H51N5O4 — CID 91479445
4-[[(4-amino-2-hydroxyphenyl)-pyridin-4-ylmethyl]amino]-4-cyclohexyl-N-[1-[(2-methylpropan-2-yl)oxy]-3-morpholin-4-ylpropan-2-yl]butanamide (PubChem CID 91479445) has the molecular formula C33H51N5O4 and a molecular weight of 581.80 g/mol. Its IUPAC name is 4-[[(4-amino-2-hydroxyphenyl)-pyridin-4-ylmethyl]amino]-4-cyclohexyl-N-[1-[(2-methylpropan-2-yl)oxy]-3-morpholin-4-ylpropan-2-yl]butanamide.
| Compound Name | 4-[[(4-amino-2-hydroxyphenyl)-pyridin-4-ylmethyl]amino]-4-cyclohexyl-N-[1-[(2-methylpropan-2-yl)oxy]-3-morpholin-4-ylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 91479445 |
| Molecular Formula | C33H51N5O4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | 4-[[(4-amino-2-hydroxyphenyl)-pyridin-4-ylmethyl]amino]-4-cyclohexyl-N-[1-[(2-methylpropan-2-yl)oxy]-3-morpholin-4-ylpropan-2-yl]butanamide |
| SMILES | CC(C)(C)OCC(CN1CCOCC1)NC(=O)CCC(NC(c1ccncc1)c1ccc(N)cc1O)C1CCCCC1 |
| InChI | InChI=1S/C33H51N5O4/c1-33(2,3)42-23-27(22-38-17-19-41-20-18-38)36-31(40)12-11-29(24-7-5-4-6-8-24)37-32(25-13-15-35-16-14-25)28-10-9-26(34)21-30(28)39/h9-10,13-16,21,24,27,29,32,37,39H,4-8,11-12,17-20,22-23,34H2,1-3H3,(H,36,40) |
| InChIKey | OBVBZHQBZQVSIN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|