C39H37N4O3S+ — CID 91485725
4-methylbenzenesulfonate;5-methyl-10-[[4-[[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl]phenyl]methyl]phenazine (PubChem CID 91485725) has the molecular formula C39H37N4O3S+ and a molecular weight of 641.82 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;5-methyl-10-[[4-[[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl]phenyl]methyl]phenazine.
| Compound Name | 4-methylbenzenesulfonate;5-methyl-10-[[4-[[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl]phenyl]methyl]phenazine |
|---|---|
| PubChem CID | 91485725 |
| Molecular Formula | C39H37N4O3S+ |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 4-methylbenzenesulfonate;5-methyl-10-[[4-[[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]methyl]phenyl]methyl]phenazine |
| SMILES | CN1c2ccccc2N(Cc2ccc(C[n+]3ccc(-c4cc[n+](C)cc4)cc3)cc2)c2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C32H30N4.C7H8O3S/c1-33-19-15-27(16-20-33)28-17-21-35(22-18-28)23-25-11-13-26(14-12-25)24-36-31-9-5-3-7-29(31)34(2)30-8-4-6-10-32(30)36;1-6-2-4-7(5-3-6)11(8,9)10/h3-22H,23-24H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+2;/p-1 |
| InChIKey | WEIPDXMNCUUZCU-UHFFFAOYSA-M |
| XLogP | 6.83 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|