C26H24N2O4S4 — CID 10929739
(5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one;4-methylbenzenesulfonate (PubChem CID 10929739) has the molecular formula C26H24N2O4S4 and a molecular weight of 556.76 g/mol. Its IUPAC name is (5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one;4-methylbenzenesulfonate.
| Compound Name | (5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10929739 |
| Molecular Formula | C26H24N2O4S4 |
| Molecular Weight | 556.76 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | (5E)-3-benzyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one;4-methylbenzenesulfonate |
| SMILES | CSC1=[N+](Cc2ccccc2)C(=O)/C(=C2\Sc3ccccc3N2C)S1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N2OS3.C7H8O3S/c1-20-14-10-6-7-11-15(14)24-18(20)16-17(22)21(19(23-2)25-16)12-13-8-4-3-5-9-13;1-6-2-4-7(5-3-6)11(8,9)10/h3-11H,12H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b18-16+; |
| InChIKey | AEFNGZPWRVEQHQ-HYNBPGMHSA-M |
| XLogP | 5.50 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|