C18H21ClN2OS3 — CID 10787867
(5E)-3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one chloride (PubChem CID 10787867) has the molecular formula C18H21ClN2OS3 and a molecular weight of 413.03 g/mol. Its IUPAC name is (5E)-3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one chloride.
| Compound Name | (5E)-3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one chloride |
|---|---|
| PubChem CID | 10787867 |
| Molecular Formula | C18H21ClN2OS3 |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | (5E)-3-cyclohexyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-1,3-thiazol-3-ium-4-one chloride |
| SMILES | CSC1=[N+](C2CCCCC2)C(=O)/C(=C2\Sc3ccccc3N2C)S1.[Cl-] |
| InChI | InChI=1S/C18H21N2OS3.ClH/c1-19-13-10-6-7-11-14(13)23-17(19)15-16(21)20(18(22-2)24-15)12-8-4-3-5-9-12;/h6-7,10-12H,3-5,8-9H2,1-2H3;1H/q+1;/p-1/b17-15+; |
| InChIKey | UXGXORAFDHFWLK-INTLEYBYSA-M |
| XLogP | 1.74 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|