C25H22N2O4S4 — CID 10745080
4-methylbenzenesulfonate;(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium-4-one (PubChem CID 10745080) has the molecular formula C25H22N2O4S4 and a molecular weight of 542.73 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium-4-one.
| Compound Name | 4-methylbenzenesulfonate;(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium-4-one |
|---|---|
| PubChem CID | 10745080 |
| Molecular Formula | C25H22N2O4S4 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 4-methylbenzenesulfonate;(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-phenyl-1,3-thiazol-3-ium-4-one |
| SMILES | CSC1=[N+](c2ccccc2)C(=O)/C(=C2\Sc3ccccc3N2C)S1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H15N2OS3.C7H8O3S/c1-19-13-10-6-7-11-14(13)23-17(19)15-16(21)20(18(22-2)24-15)12-8-4-3-5-9-12;1-6-2-4-7(5-3-6)11(8,9)10/h3-11H,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1/b17-15+; |
| InChIKey | AZKXDHWHBBFOJB-INTLEYBYSA-M |
| XLogP | 5.63 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|