C15H15N2OS3+ — CID 11134961
(5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-prop-2-enyl-1,3-thiazol-3-ium-4-one (PubChem CID 11134961) has the molecular formula C15H15N2OS3+ and a molecular weight of 335.50 g/mol. Its IUPAC name is (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-prop-2-enyl-1,3-thiazol-3-ium-4-one.
| Compound Name | (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-prop-2-enyl-1,3-thiazol-3-ium-4-one |
|---|---|
| PubChem CID | 11134961 |
| Molecular Formula | C15H15N2OS3+ |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (5E)-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanyl-3-prop-2-enyl-1,3-thiazol-3-ium-4-one |
| SMILES | C=CC[N+]1=C(SC)S/C(=C2/Sc3ccccc3N2C)C1=O |
| InChI | InChI=1S/C15H15N2OS3/c1-4-9-17-13(18)12(21-15(17)19-3)14-16(2)10-7-5-6-8-11(10)20-14/h4-8H,1,9H2,2-3H3/q+1/b14-12+ |
| InChIKey | PUYMCTHZQGYENE-WYMLVPIESA-N |
| XLogP | 3.59 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|