C16H20N3OS2+ — CID 10623875
(5E)-1,3-diethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanylimidazol-1-ium-4-one (PubChem CID 10623875) has the molecular formula C16H20N3OS2+ and a molecular weight of 334.49 g/mol. Its IUPAC name is (5E)-1,3-diethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanylimidazol-1-ium-4-one.
| Compound Name | (5E)-1,3-diethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanylimidazol-1-ium-4-one |
|---|---|
| PubChem CID | 10623875 |
| Molecular Formula | C16H20N3OS2+ |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (5E)-1,3-diethyl-5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-methylsulfanylimidazol-1-ium-4-one |
| SMILES | CCN1C(=O)/C(=C2\Sc3ccccc3N2C)[N+](CC)=C1SC |
| InChI | InChI=1S/C16H20N3OS2/c1-5-18-13(14(20)19(6-2)16(18)21-4)15-17(3)11-9-7-8-10-12(11)22-15/h7-10H,5-6H2,1-4H3/q+1/b15-13+ |
| InChIKey | QQXIXOKWVYICIH-FYWRMAATSA-N |
| XLogP | 3.01 |
| TPSA | 26.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|