C23H24N2O6S4 — CID 139634178
2-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)sulfonyloxy-2-methylsulfanyl-4-oxo-1,3-thiazolidin-3-yl]ethyl acetate (PubChem CID 139634178) has the molecular formula C23H24N2O6S4 and a molecular weight of 552.72 g/mol. Its IUPAC name is 2-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)sulfonyloxy-2-methylsulfanyl-4-oxo-1,3-thiazolidin-3-yl]ethyl acetate.
| Compound Name | 2-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)sulfonyloxy-2-methylsulfanyl-4-oxo-1,3-thiazolidin-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 139634178 |
| Molecular Formula | C23H24N2O6S4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 2-[5-(3-methyl-1,3-benzothiazol-2-ylidene)-2-(4-methylphenyl)sulfonyloxy-2-methylsulfanyl-4-oxo-1,3-thiazolidin-3-yl]ethyl acetate |
| SMILES | CSC1(OS(=O)(=O)c2ccc(C)cc2)SC(=C2Sc3ccccc3N2C)C(=O)N1CCOC(C)=O |
| InChI | InChI=1S/C23H24N2O6S4/c1-15-9-11-17(12-10-15)35(28,29)31-23(32-4)25(13-14-30-16(2)26)21(27)20(34-23)22-24(3)18-7-5-6-8-19(18)33-22/h5-12H,13-14H2,1-4H3 |
| InChIKey | LXDRLPQXCVLHLZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|