C17H22N2O4S4 — CID 139772553
[3-ethyl-2-methylsulfanyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-yl] 4-methylbenzenesulfonate (PubChem CID 139772553) has the molecular formula C17H22N2O4S4 and a molecular weight of 446.64 g/mol. Its IUPAC name is [3-ethyl-2-methylsulfanyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [3-ethyl-2-methylsulfanyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139772553 |
| Molecular Formula | C17H22N2O4S4 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | [3-ethyl-2-methylsulfanyl-5-(3-methyl-1,3-thiazolidin-2-ylidene)-4-oxo-1,3-thiazolidin-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCN1C(=O)C(=C2SCCN2C)SC1(OS(=O)(=O)c1ccc(C)cc1)SC |
| InChI | InChI=1S/C17H22N2O4S4/c1-5-19-15(20)14(16-18(3)10-11-25-16)26-17(19,24-4)23-27(21,22)13-8-6-12(2)7-9-13/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | YRMUQSOHJHXNFA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|