C21H32N4O3 — CID 91487965
tert-butyl N-[1-[benzyl(pyrrolidin-3-yl)carbamoyl]pyrrolidin-3-yl]carbamate (PubChem CID 91487965) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl N-[1-[benzyl(pyrrolidin-3-yl)carbamoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[benzyl(pyrrolidin-3-yl)carbamoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91487965 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl N-[1-[benzyl(pyrrolidin-3-yl)carbamoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)N(Cc2ccccc2)C2CCNC2)C1 |
| InChI | InChI=1S/C21H32N4O3/c1-21(2,3)28-19(26)23-17-10-12-24(15-17)20(27)25(18-9-11-22-13-18)14-16-7-5-4-6-8-16/h4-8,17-18,22H,9-15H2,1-3H3,(H,23,26) |
| InChIKey | MDAZKYTVYGKWCX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |