C45H89N7O2 — CID 91491188
N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperidin-1-yl)ethyl]piperazin-2-one (PubChem CID 91491188) has the molecular formula C45H89N7O2 and a molecular weight of 760.25 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperidin-1-yl)ethyl]piperazin-2-one.
| Compound Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperidin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 91491188 |
| Molecular Formula | C45H89N7O2 |
| Molecular Weight | 760.25 g/mol |
| Exact Mass | 759.71 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperidin-1-yl)ethyl]piperazin-2-one |
| SMILES | CC1(C)CN(CCN2CC(C)(C)NC(C)(C)C2=O)C(=O)C(C)(C)C1.CN(CCCCCCN(C)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H54N4.C19H35N3O2/c1-23(2)17-21(18-24(3,4)27-23)29(9)15-13-11-12-14-16-30(10)22-19-25(5,6)28-26(7,8)20-22;1-16(2)11-17(3,4)14(23)21(12-16)9-10-22-13-18(5,6)20-19(7,8)15(22)24/h21-22,27-28H,11-20H2,1-10H3;20H,9-13H2,1-8H3 |
| InChIKey | GZJPXCRMCBEMHI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.25 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|