C14H27N — CID 91492234
ethane;3-methyl-1,4,5,6,7,8-hexahydroisoquinoline (PubChem CID 91492234) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;3-methyl-1,4,5,6,7,8-hexahydroisoquinoline.
| Compound Name | ethane;3-methyl-1,4,5,6,7,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 91492234 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;3-methyl-1,4,5,6,7,8-hexahydroisoquinoline |
| SMILES | CC.CC.CC1=NCC2=C(CCCC2)C1 |
| InChI | InChI=1S/C10H15N.2C2H6/c1-8-6-9-4-2-3-5-10(9)7-11-8;2*1-2/h2-7H2,1H3;2*1-2H3 |
| InChIKey | VKKFLWHOJVMJHX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|