C22H19ClF4N6O2 — CID 91495307
2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol (PubChem CID 91495307) has the molecular formula C22H19ClF4N6O2 and a molecular weight of 510.88 g/mol. Its IUPAC name is 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol.
| Compound Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol |
|---|---|
| PubChem CID | 91495307 |
| Molecular Formula | C22H19ClF4N6O2 |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-[3-(trifluoromethyl)anilino]phenol |
| SMILES | Oc1c(C/N=N/c2ncc(F)c(N3CCOCC3)n2)ccc(Nc2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C22H19ClF4N6O2/c23-18-17(30-15-3-1-2-14(10-15)22(25,26)27)5-4-13(19(18)34)11-29-32-21-28-12-16(24)20(31-21)33-6-8-35-9-7-33/h1-5,10,12,30,34H,6-9,11H2/b32-29+ |
| InChIKey | PNSXALSZWSUVNE-UUDCSCGESA-N |
| XLogP | 5.86 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|