C21H18BrCl2FN6O3 — CID 90771537
3-(5-bromo-3-chloro-2-hydroxyanilino)-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol (PubChem CID 90771537) has the molecular formula C21H18BrCl2FN6O3 and a molecular weight of 572.22 g/mol. Its IUPAC name is 3-(5-bromo-3-chloro-2-hydroxyanilino)-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol.
| Compound Name | 3-(5-bromo-3-chloro-2-hydroxyanilino)-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 90771537 |
| Molecular Formula | C21H18BrCl2FN6O3 |
| Molecular Weight | 572.22 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | 3-(5-bromo-3-chloro-2-hydroxyanilino)-2-chloro-6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]phenol |
| SMILES | Oc1c(Cl)cc(Br)cc1Nc1ccc(C/N=N/c2ncc(F)c(N3CCOCC3)n2)c(O)c1Cl |
| InChI | InChI=1S/C21H18BrCl2FN6O3/c22-12-7-13(23)19(33)16(8-12)28-15-2-1-11(18(32)17(15)24)9-27-30-21-26-10-14(25)20(29-21)31-3-5-34-6-4-31/h1-2,7-8,10,28,32-33H,3-6,9H2/b30-27+ |
| InChIKey | KGACJEOWJFHGFX-KDJFERLWSA-N |
| XLogP | 5.96 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.22 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|